
CAS 1269429-27-7
:4-Cyclopropyl-6-methyl-2-pyrimidinemethanamine
Description:
4-Cyclopropyl-6-methyl-2-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a cyclopropyl group and a methyl group at specific positions contributes to its unique chemical properties and potential biological activity. This compound may exhibit interesting pharmacological effects, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The amine functional group indicates that it can participate in hydrogen bonding, which may enhance its solubility and reactivity. As with many pyrimidine derivatives, it could be explored for applications in drug development, particularly in areas such as oncology or neurology. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation through experimental studies and literature reviews.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c1-6-4-8(7-2-3-7)12-9(5-10)11-6/h4,7H,2-3,5,10H2,1H3
InChI key:InChIKey=NCICAVTUJZBMSH-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(C=C(C)N1)C2CC2
Synonyms:- 4-Cyclopropyl-6-methyl-2-pyrimidinemethanamine
- 2-Pyrimidinemethanamine, 4-cyclopropyl-6-methyl-
- (4-Cyclopropyl-6-methylpyrimidin-2-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
