CymitQuimica logo

CAS 1269440-54-1

:

4-[3-Iodo-1-(1-methylethyl)-1H-pyrazol-4-yl]-2-pyrimidinamine

Description:
4-[3-Iodo-1-(1-methylethyl)-1H-pyrazol-4-yl]-2-pyrimidinamine is a chemical compound characterized by its complex structure, which includes a pyrazole and a pyrimidine moiety. The presence of an iodine atom in the pyrazole ring contributes to its potential reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets, making it of interest in medicinal chemistry. The presence of the isopropyl group (1-methylethyl) can influence its lipophilicity and overall pharmacokinetic profile. Additionally, the compound may exhibit various functional properties, including potential anti-cancer or anti-inflammatory activities, depending on its specific interactions within biological systems. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research settings to explore its potential therapeutic applications. As with many compounds in this category, safety and handling precautions are essential due to the presence of iodine and the potential for biological activity.
Formula:C10H12IN5
InChI:InChI=1S/C10H12IN5/c1-6(2)16-5-7(9(11)15-16)8-3-4-13-10(12)14-8/h3-6H,1-2H3,(H2,12,13,14)
InChI key:InChIKey=KWNDFHCAHOPJIT-UHFFFAOYSA-N
SMILES:IC=1C(=CN(C(C)C)N1)C2=NC(N)=NC=C2
Synonyms:
  • 4-[3-Iodo-1-(1-methylethyl)-1H-pyrazol-4-yl]-2-pyrimidinamine
  • 2-Pyrimidinamine, 4-[3-iodo-1-(1-methylethyl)-1H-pyrazol-4-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.