CAS 1269514-88-6

4-(2-Phenylethyl)-2-(phenylmethoxy)-1,3(2H,4H)-isoquinolinedione

Description:

4-(2-Phenylethyl)-2-(phenylmethoxy)-1,3(2H,4H)-isoquinolinedione, with the CAS number 1269514-88-6, is a synthetic organic compound that belongs to the isoquinoline family. This compound features a complex structure characterized by an isoquinoline backbone, which is fused with a diketone moiety. The presence of phenyl and phenylethyl substituents contributes to its aromatic character, potentially influencing its solubility and reactivity. Isoquinolinediones are known for their biological activities, including potential applications in medicinal chemistry, where they may exhibit properties such as anti-inflammatory or anticancer effects. The compound's molecular structure suggests it may engage in various interactions, including hydrogen bonding and π-π stacking, which could affect its pharmacokinetics and pharmacodynamics. Additionally, the presence of multiple aromatic rings may enhance its stability and lipophilicity, making it a candidate for further research in drug development. Overall, this compound represents a class of molecules with significant potential in pharmaceutical applications, warranting further investigation into its properties and biological activities.

Formula: C₂₄H₂₁NO₃

InChI: InChI=1S/C24H21NO3/c26-23-21-14-8-7-13-20(21)22(16-15-18-9-3-1-4-10-18)24(27)25(23)28-17-19-11-5-2-6-12-19/h1-14,22H,15-17H2

InChI key: InChIKey=VCSFLEYSJVECHV-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)C2C=3C(C(=O)N(OCC4=CC=CC=C4)C2=O)=CC=CC3

Synonyms:

• 4-(2-Phenylethyl)-2-(phenylmethoxy)-1,3(2H,4H)-isoquinolinedione
• 2-(Benzyloxy)-4-phenethylisoquinoline-1,3(2H,4H)-dione
• 1,3(2H,4H)-Isoquinolinedione, 4-(2-phenylethyl)-2-(phenylmethoxy)-

2-(Benzyloxy)-4-phenethylisoquinoline-1,3(2H,4H)-dione

CAS: 1269514-88-6

Formula: C₂₄H₂₁NO₃

Molecular weight: 371.4284

Ref: IN-DA000WGT

2-(Benzyloxy)-4-phenethylisoquinoline-1,3(2H,4H)-dione

CAS: 1269514-88-6

2-(Benzyloxy)-4-phenethylisoquinoline-1,3(2H,4H)-dione is a versatile building block that can be used in the synthesis of complex compounds. It has been used as a reagent and as a speciality chemical. This compound is an intermediate in the synthesis of 2-(benzyloxy)isoquinoline-1,3(2H,4H)-diones. 2-(Benzyloxy)-4-phenethylisoquinoline-1,3(2H,4H)-dione is also a useful scaffold for organic reactions.

Formula: C₂₄H₂₁NO₃

Purity: Min. 95%

Molecular weight: 371.4 g/mol

Ref: 3D-UAC51488