CymitQuimica logo

CAS 1269525-47-4

:

1′,4′-Dihydro-2′-(1-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid

Description:
1′,4′-Dihydro-2′-(1-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of cyclohexane and isoquinoline. This compound features a dihydroisoquinoline moiety, indicating it has undergone partial hydrogenation, contributing to its stability and potential biological activity. The presence of a carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the 1-methylpropyl substituent introduces hydrophobic characteristics, which can affect the compound's interactions with biological membranes and its overall pharmacokinetics. The intricate arrangement of its atoms and functional groups may also confer specific stereochemical properties, potentially impacting its biological activity and interactions with target molecules. Overall, this compound's structural complexity and functional groups make it a subject of interest in medicinal chemistry and drug development, particularly in exploring its potential therapeutic applications.
Formula:C19H25NO3
InChI:InChI=1S/C19H25NO3/c1-3-13(2)20-17(21)15-10-6-5-9-14(15)16(18(22)23)19(20)11-7-4-8-12-19/h5-6,9-10,13,16H,3-4,7-8,11-12H2,1-2H3,(H,22,23)
InChI key:InChIKey=DDBQDAAACTYCSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2(N(C(CC)C)C(=O)C=3C1=CC=CC3)CCCCC2
Synonyms:
  • Spiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid, 1′,4′-dihydro-2′-(1-methylpropyl)-1′-oxo-
  • 1′,4′-Dihydro-2′-(1-methylpropyl)-1′-oxospiro[cyclohexane-1,3′(2′H)-isoquinoline]-4′-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.