
CAS 1269527-50-5
:5-(3-Fluorophenyl)-2-furanpropanoic acid
Description:
5-(3-Fluorophenyl)-2-furanpropanoic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a propanoic acid moiety. The presence of a fluorine atom on the phenyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of both aromatic and carboxylic acid functionalities, such as potential acidity and the ability to participate in hydrogen bonding. Its furan component may contribute to its reactivity and stability under certain conditions. The compound's molecular interactions can be significant in pharmaceutical applications, particularly in drug design, where modifications to the phenyl or furan rings can affect pharmacokinetics and pharmacodynamics. Additionally, the presence of the fluorine atom can enhance metabolic stability and alter the compound's interaction with biological targets. Overall, 5-(3-Fluorophenyl)-2-furanpropanoic acid represents a class of compounds that may have potential therapeutic applications, warranting further investigation into its properties and effects.
Formula:C13H11FO3
InChI:InChI=1S/C13H11FO3/c14-10-3-1-2-9(8-10)12-6-4-11(17-12)5-7-13(15)16/h1-4,6,8H,5,7H2,(H,15,16)
InChI key:InChIKey=AGUTYPUEBXRFMM-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1OC(=CC1)C2=CC(F)=CC=C2
Synonyms:- 2-Furanpropanoic acid, 5-(3-fluorophenyl)-
- 5-(3-Fluorophenyl)-2-furanpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.