
CAS 1269528-39-3
:3,5-Dichloro-6-(3-chlorophenyl)-1-methyl-2(1H)-pyrazinone
Description:
3,5-Dichloro-6-(3-chlorophenyl)-1-methyl-2(1H)-pyrazinone is a synthetic organic compound characterized by its pyrazinone structure, which features a pyrazine ring fused with a carbonyl group. This compound contains multiple chlorine substituents, specifically at the 3 and 5 positions of the pyrazinone ring, and a chlorophenyl group at the 6 position, contributing to its potential biological activity and lipophilicity. The presence of the methyl group at the 1 position enhances its stability and solubility in organic solvents. As a halogenated compound, it may exhibit unique reactivity and interactions with biological systems, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. However, specific properties such as melting point, boiling point, solubility, and toxicity would require empirical data for precise characterization. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules in chemical research.
Formula:C11H7Cl3N2O
InChI:InChI=1S/C11H7Cl3N2O/c1-16-8(6-3-2-4-7(12)5-6)9(13)15-10(14)11(16)17/h2-5H,1H3
InChI key:InChIKey=LGIIMCPIZRWLOW-UHFFFAOYSA-N
SMILES:CN1C(=C(Cl)N=C(Cl)C1=O)C2=CC(Cl)=CC=C2
Synonyms:- 3,5-Dichloro-6-(3-chlorophenyl)-1-methyl-2(1H)-pyrazinone
- 2(1H)-Pyrazinone, 3,5-dichloro-6-(3-chlorophenyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.