CymitQuimica logo

CAS 1269528-61-1

:

4-(2-Furanyl)-3,5-dihydro-2-methyl-3-(methylthio)-1H-pyrrolo[3,4-c]pyridine-1,6(2H)-dione

Description:
4-(2-Furanyl)-3,5-dihydro-2-methyl-3-(methylthio)-1H-pyrrolo[3,4-c]pyridine-1,6(2H)-dione is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a furan ring contributes to its aromatic properties, while the methylthio group enhances its reactivity and potential for forming various derivatives. This compound is likely to exhibit interesting biological activities due to its structural features, which may influence its interaction with biological targets. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, such as the methyl and methylthio substituents. Additionally, its synthesis may involve multi-step organic reactions, highlighting its complexity. Overall, this compound represents a fascinating subject for further research in both synthetic and applied chemistry contexts.
Formula:C13H12N2O3S
InChI:InChI=1S/C13H12N2O3S/c1-15-12(17)7-6-9(16)14-11(8-4-3-5-18-8)10(7)13(15)19-2/h3-6,13H,1-2H3,(H,14,16)
InChI key:InChIKey=RFAKGJOZQLBPMJ-UHFFFAOYSA-N
SMILES:S(C)C1C2=C(NC(=O)C=C2C(=O)N1C)C3=CC=CO3
Synonyms:
  • 1H-Pyrrolo[3,4-c]pyridine-1,6(2H)-dione, 4-(2-furanyl)-3,5-dihydro-2-methyl-3-(methylthio)-
  • 4-(2-Furanyl)-3,5-dihydro-2-methyl-3-(methylthio)-1H-pyrrolo[3,4-c]pyridine-1,6(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.