CAS 126959-88-4
:bradykinin, Sar-(D-Phe(8))des-Arg(9)
Description:
Bradykinin, Sar-(D-Phe(8))des-Arg(9) is a synthetic analog of the naturally occurring peptide bradykinin, which is known for its role in vasodilation and inflammatory responses. This compound is characterized by its specific amino acid sequence, which includes a substitution at position 8 with D-phenylalanine (D-Phe) and a deletion of the arginine residue at position 9. These modifications enhance its stability and potency compared to the native bradykinin. The substance acts primarily on bradykinin receptors, influencing various physiological processes such as blood pressure regulation, pain sensation, and immune responses. Its pharmacological properties make it a subject of interest in research related to cardiovascular health and inflammatory conditions. Additionally, the presence of the D-amino acid in its structure contributes to its resistance to enzymatic degradation, allowing for prolonged activity in biological systems. Overall, Sar-(D-Phe(8))des-Arg(9) serves as a valuable tool in understanding the mechanisms of bradykinin and its potential therapeutic applications.
Formula:C47H66N12O11
InChI:InChI=1/C47H66N12O11/c1-50-26-38(61)53-31(16-8-20-51-47(48)49)43(66)59-23-11-19-37(59)45(68)58-22-9-17-35(58)41(64)52-27-39(62)54-32(24-29-12-4-2-5-13-29)40(63)56-34(28-60)44(67)57-21-10-18-36(57)42(65)55-33(46(69)70)25-30-14-6-3-7-15-30/h2-7,12-15,31-37,50,60H,8-11,16-28H2,1H3,(H,52,64)(H,53,61)(H,54,62)(H,55,65)(H,56,63)(H,69,70)(H4,48,49,51)/t31-,32-,33+,34-,35-,36-,37-/m0/s1
Synonyms:- Sar-(D-phe(8))des-arg(9)-BK
- Spa-BK
- Bradykinin, N2-(N-methylglycyl)-8-D-phenylalanine-9-de-L-arginine-
- N-methylglycyl-N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-prolylglycyl-L-phenylalanyl-L-seryl-L-prolyl-D-phenylalanine
- Bradykinin, sar-(D-phe(8))des-arg(9)
- 1-8-Bradykinin, N2-(N-methylglycyl)-8-D-phenylalanine-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-8-Bradykinin, N2-(N-methylglycyl)-8-D-phenylalanine-
CAS:Formula:C47H66N12O11Purity:98%Molecular weight:975.1007Sar-[D-Phe8]-des-Arg9-Bradykinin
CAS:Potent bradykinin B1 agonist, EC50 = 9.02 nM, enzyme resistant, induces hypotension and angiogenesis.Formula:C47H66N12O11Purity:98%Color and Shape:SolidMolecular weight:975.11Sar-[D-Phe8]-des-Arg9-bradykinin
CAS:<p>Sar-[D-Phe8]-des-Arg9-bradykinin is a selective Bradykinin B1 receptor agonist that exhibits resistance to aminopeptidase cleavage. This peptide plays a crucial role in various physiological processes, including inflammation, pain perception, and angiogenesis. Sar-[D-Phe8]-des-Arg9-bradykinin has been shown to have potent hypotensive effects and can stimulate the release of prostaglandins and nitric oxide. It is resistant to endopeptidase cleavage, making it an ideal candidate for therapeutic applications. Additionally, this peptide has been found to possess antibacterial properties against certain bacteria strains. Sar-[D-Phe8]-des-Arg9-bradykinin is available in pure form with minimal impurities, ensuring its efficacy and safety for use in research and medical applications.</p>Formula:C47H66N12O11Purity:Min. 95%Molecular weight:975.1 g/mol


