CAS 1269755-60-3

6,6-Dimethyl-1-(phenylmethyl)-3-piperidinecarboxylic acid

Description:

6,6-Dimethyl-1-(phenylmethyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of two methyl groups at the 6-position and a phenylmethyl group at the 1-position contributes to its unique properties and potential biological activity. This compound is likely to exhibit moderate lipophilicity due to the aromatic phenyl group, which can influence its solubility and permeability in biological systems. The carboxylic acid functional group at the 3-position is polar and can participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Such structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific data regarding its pharmacological effects, toxicity, and synthesis may require further investigation and are not universally established. As with any chemical substance, proper handling and safety protocols should be observed when working with this compound.

Formula: C₁₅H₂₁NO₂

InChI: InChI=1S/C15H21NO2/c1-15(2)9-8-13(14(17)18)11-16(15)10-12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H,17,18)

InChI key: InChIKey=IBSMILLSZXGQDY-UHFFFAOYSA-N

SMILES: C(N1C(C)(C)CCC(C(O)=O)C1)C2=CC=CC=C2

Synonyms:

• 1-Benzyl-6,6-dimethylpiperidine-3-carboxylic acid
• 6,6-Dimethyl-1-(phenylmethyl)-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 6,6-dimethyl-1-(phenylmethyl)-