CAS 1269801-74-2

2-[[2-(2,2,2-Trifluoroethoxy)phenoxy]methyl]-1,3-dioxolane

Description:

2-[[2-(2,2,2-Trifluoroethoxy)phenoxy]methyl]-1,3-dioxolane is an organic compound characterized by its complex structure, which includes a dioxolane ring and a trifluoroethoxy group. This compound features a phenoxy moiety, indicating the presence of a phenolic structure linked to an ether group. The trifluoroethoxy substituent contributes to its unique properties, including increased hydrophobicity and potential applications in various chemical processes. The dioxolane ring is known for its stability and ability to participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the presence of fluorine atoms can enhance the compound's biological activity and influence its interactions with other molecules. Overall, this compound's characteristics suggest it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and testing. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can exhibit unique environmental and health impacts.

Formula: C₁₂H₁₃F₃O₄

InChI: InChI=1S/C12H13F3O4/c13-12(14,15)8-19-10-4-2-1-3-9(10)18-7-11-16-5-6-17-11/h1-4,11H,5-8H2

InChI key: InChIKey=BUEPPELPFFFAQZ-UHFFFAOYSA-N

SMILES: O(CC1OCCO1)C2=C(OCC(F)(F)F)C=CC=C2

Synonyms:

• 2-[[2-(2,2,2-Trifluoroethoxy)phenoxy]methyl]-1,3-dioxolane
• 1,3-Dioxolane, 2-[[2-(2,2,2-trifluoroethoxy)phenoxy]methyl]-

2-[[2-(2,2,2-Trifluoroethoxy)phenoxy]methyl]-1,3-dioxolane

Controlled Product

CAS: 1269801-74-2

Formula: C₂₇H₂₄O₈

Color and Shape: Neat

Molecular weight: 476.475

Ref: TR-T790185