CAS 1269822-96-9
:4-Hydroxy-7H-pyrrolo[2,3-c]pyridazine-6-carboxylic acid
Description:
4-Hydroxy-7H-pyrrolo[2,3-c]pyridazine-6-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes both pyrrole and pyridazine rings. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH), contributing to its potential as a bioactive molecule. The presence of these functional groups suggests that it may exhibit acidic properties and participate in hydrogen bonding, influencing its solubility and reactivity. The compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, its specific arrangement of nitrogen and carbon atoms can impart unique electronic properties, potentially affecting its behavior in various chemical reactions. As with many heterocycles, the stability and reactivity of 4-Hydroxy-7H-pyrrolo[2,3-c]pyridazine-6-carboxylic acid can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C7H5N3O3
InChI:InChI=1S/C7H5N3O3/c11-5-2-8-10-6-3(5)1-4(9-6)7(12)13/h1-2H,(H,12,13)(H2,9,10,11)
InChI key:InChIKey=AMYSDDVREWVHKF-UHFFFAOYSA-N
SMILES:OC1=C2C(NC(C(O)=O)=C2)=NN=C1
Synonyms:- 4-Hydroxy-7H-pyrrolo[2,3-c]pyridazine-6-carboxylic acid
- 7H-Pyrrolo[2,3-c]pyridazine-6-carboxylic acid, 4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.