
CAS 1269822-97-0
:7H-Pyrrolo[2,3-c]pyridazin-4-ol
Description:
7H-Pyrrolo[2,3-c]pyridazin-4-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridazine ring. This compound features a hydroxyl group (-OH) at the 4-position of the pyridazine ring, contributing to its potential reactivity and solubility in polar solvents. The presence of nitrogen atoms in the rings imparts distinct electronic properties, making it of interest in medicinal chemistry and material science. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its biological activity and stability. The compound may exhibit pharmacological properties, making it a candidate for further research in drug development. Additionally, its synthesis and characterization are essential for understanding its behavior in different chemical environments. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, making it a versatile subject for study in organic and medicinal chemistry.
Formula:C6H5N3O
InChI:InChI=1S/C6H5N3O/c10-5-3-8-9-6-4(5)1-2-7-6/h1-3H,(H2,7,9,10)
InChI key:InChIKey=NAJJFOGIBOIKQF-UHFFFAOYSA-N
SMILES:OC1=C2C(=NN=C1)NC=C2
Synonyms:- 7H-Pyrrolo[2,3-c]pyridazin-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.