CymitQuimica logo

CAS 126991-59-1

:

8-(4-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol

Description:
8-(4-Chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol is a chemical compound characterized by its unique spirocyclic structure, which consists of a dioxaspiro framework and a chlorophenyl substituent. The presence of the 4-chlorophenyl group contributes to its potential biological activity and lipophilicity, influencing its interactions with biological systems. The compound features a hydroxyl (-OH) group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. Its spirocyclic nature may impart rigidity to the molecule, affecting its conformational dynamics and reactivity. This compound is of interest in medicinal chemistry and pharmacology due to its structural features, which may lead to specific interactions with biological targets. Additionally, the presence of the dioxaspiro moiety suggests potential applications in the development of novel therapeutic agents. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C14H17ClO3
InChI:InChI=1/C14H17ClO3/c15-12-3-1-11(2-4-12)13(16)5-7-14(8-6-13)17-9-10-18-14/h1-4,16H,5-10H2
SMILES:c1cc(ccc1C1(CCC2(CC1)OCCO2)O)Cl
Synonyms:
  • 8-(4-Chloro-phenyl)-1,4-dioxa-spiro[4.5]decan-8-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.