CAS 126991-60-4
:8-(4-Chlorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene
Description:
8-(4-Chlorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene, identified by its CAS number 126991-60-4, is a chemical compound characterized by its unique spirocyclic structure, which features a dioxaspiro framework. This compound contains a chlorophenyl group, contributing to its potential biological activity and chemical reactivity. The presence of the dioxaspiro moiety suggests that it may exhibit interesting conformational properties and could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks. The chlorophenyl substituent may enhance lipophilicity, potentially influencing its solubility and interaction with biological targets. Additionally, compounds with similar structures have been studied for their pharmacological properties, including anti-inflammatory and anticancer activities. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference. Overall, 8-(4-Chlorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene represents a compound of interest in medicinal chemistry and materials science due to its structural features and potential applications.
Formula:C14H15ClO2
InChI:InChI=1S/C14H15ClO2/c15-13-3-1-11(2-4-13)12-5-7-14(8-6-12)16-9-10-17-14/h1-5H,6-10H2
InChI key:InChIKey=FSVPTHZYWZDTIK-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=2CCC3(CC2)OCCO3)C=C1
Synonyms:- 8-(4-Chloro-phenyl)-1,4-dioxa-spiro[4.5]dec-7-ene
- 8-(4-Chlorophenyl)-1,4-dioxaspiro[4.5]dec-7-ene
- 1,4-Dioxaspiro[4.5]dec-7-ene, 8-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.