
CAS 126993-72-4
:6-(Phenylmethoxy)-2-pyrazinamine
Description:
6-(Phenylmethoxy)-2-pyrazinamine is a chemical compound characterized by its pyrazinamine core, which features a pyrazine ring substituted with an amino group and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the phenylmethoxy group may enhance its lipophilicity, influencing its biological activity and interaction with various biological targets. Additionally, the amino group can participate in hydrogen bonding, which may affect its reactivity and potential applications in medicinal chemistry. Compounds like this are often studied for their pharmacological properties, including potential roles as intermediates in drug synthesis or as active pharmaceutical ingredients. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c12-10-6-13-7-11(14-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,14)
InChI key:InChIKey=ZSRANPPJBKMMSP-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=NC(N)=CN=C2
Synonyms:- 2-Pyrazinamine, 6-(phenylmethoxy)-
- Pyrazinamine, 6-(phenylmethoxy)-
- 6-(Phenylmethoxy)-2-pyrazinamine
- 2-Amino-6-benzyloxypyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.