CAS 127-17-3: Pyruvic acid
Description:Pyruvic acid, with the CAS number 127-17-3, is a key intermediate in several metabolic pathways, particularly in glycolysis, where it is produced from glucose. It is a colorless liquid with a slightly pungent odor and is soluble in water, ethanol, and ether. The molecular formula of pyruvic acid is C3H4O3, and it has a carboxylic acid functional group, which contributes to its acidic properties. Pyruvic acid can exist in equilibrium with its ionized form, pyruvate, depending on the pH of the solution. It plays a crucial role in cellular respiration, serving as a substrate for the Krebs cycle when oxygen is present or being converted to lactate under anaerobic conditions. Additionally, pyruvic acid is utilized in various industrial applications, including food preservation, flavoring, and as a precursor for the synthesis of other organic compounds. Its reactivity allows it to participate in various chemical reactions, making it an important compound in both biochemistry and organic chemistry.
Formula:C3H4O3
InChI:InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)
InChI key:InChIKey=LCTONWCANYUPML-UHFFFAOYSA-N
SMILES:O=C(O)C(=O)C
- Synonyms:
- 2-Ketopropionic acid
- 2-Oxopropanoate
- 2-Oxopropanoic acid
- 2-Oxopropionic acid
- Acetylformic acid
- Acide pyruvique
- Acido Piruvico
- BTS
- Brenztraubensaure
- Nsc 179
- See more synonyms
- Propanoic acid, 2-oxo-
- Pyroracemic acid
- Pyruvic acid,(2-Oxopropionic acid)
- α-Ketopropionic acid
- Pyruvic acid