CAS 127-43-5
:β-Iraldeine
Description:
β-Iraldeine, with the CAS number 127-43-5, is an organic compound that belongs to the class of alkaloids. It is characterized by its complex molecular structure, which includes a bicyclic framework. This compound is typically found in certain plant species and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. β-Iraldeine is often studied for its pharmacological effects, making it of interest in medicinal chemistry and natural product research. The compound is usually encountered as a solid at room temperature and may exhibit solubility in various organic solvents. Its reactivity can be influenced by functional groups present in its structure, which may participate in various chemical reactions. As with many alkaloids, β-Iraldeine's safety profile and toxicity are important considerations in its application and study. Overall, β-Iraldeine represents a significant area of interest in both synthetic and natural product chemistry due to its diverse potential applications.
Formula:C14H22O
InChI:InChI=1S/C14H22O/c1-5-12(15)8-9-13-11(2)7-6-10-14(13,3)4/h8-9H,5-7,10H2,1-4H3
InChI key:InChIKey=LMWNGLDCJDIIBR-UHFFFAOYSA-N
SMILES:C(=CC(CC)=O)C=1C(C)(C)CCCC1C
Synonyms:- 1-Penten-3-one, 1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-
- NSC 163995
- 5-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-4-penten-3-one
- β-Iraldeine
- 1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-1-penten-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
