CymitQuimica logo

CAS 1270034-32-6

:

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-(2-pyridinyl)-4-thiazolecarboxylic acid

Description:
5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-(2-pyridinyl)-4-thiazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyridine moiety, and an amino acid functional group. This compound features a dimethylethoxycarbonyl group that enhances its solubility and stability, making it suitable for various applications in medicinal chemistry. The presence of the thiazole and pyridine rings suggests potential biological activity, as these heterocycles are often found in pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and reactivity, allowing for potential interactions with biological targets. Additionally, the compound's unique structural features may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Overall, this compound represents a class of molecules that may exhibit significant therapeutic potential, warranting further investigation into its biological effects and applications in drug development.
Formula:C14H15N3O4S
InChI:InChI=1S/C14H15N3O4S/c1-14(2,3)21-13(20)17-11-9(12(18)19)16-10(22-11)8-6-4-5-7-15-8/h4-7H,1-3H3,(H,17,20)(H,18,19)
InChI key:InChIKey=BRLUKIJLYVLLJZ-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C=1SC(=NC1C(O)=O)C2=CC=CC=N2
Synonyms:
  • 4-Thiazolecarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-2-(2-pyridinyl)-
  • 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-(2-pyridinyl)-4-thiazolecarboxylic acid
  • 5-(tert-Butoxycarbonylamino)-2-(pyridin-2-yl)thiazole-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.