CAS 1270093-03-2

(αS,βR)-β-Amino-3,5-dichloro-α-methylbenzeneethanol

Description:

(αS,βR)-β-Amino-3,5-dichloro-α-methylbenzeneethanol is a chiral compound characterized by its specific stereochemistry, indicated by the (αS,βR) notation. This compound features an amino group, which contributes to its potential as a biological active agent, possibly influencing neurotransmitter systems or serving as a pharmaceutical intermediate. The presence of dichloro substituents on the aromatic ring enhances its reactivity and may affect its solubility and interaction with biological targets. The α-methyl group introduces steric hindrance, which can influence the compound's conformation and, consequently, its biological activity. As a secondary alcohol, it can participate in various chemical reactions, including oxidation and esterification. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential applications and safety profile.

Formula: C₉H₁₁Cl₂NO

InChI: InChI=1S/C9H11Cl2NO/c1-5(13)9(12)6-2-7(10)4-8(11)3-6/h2-5,9,13H,12H2,1H3/t5-,9-/m0/s1

InChI key: InChIKey=HKYDFXFCJNJWNZ-CDUCUWFYSA-N

SMILES: [C@@H]([C@H](C)O)(N)C1=CC(Cl)=CC(Cl)=C1

Synonyms:

• (αS,βR)-β-Amino-3,5-dichloro-α-methylbenzeneethanol
• Benzeneethanol, β-amino-3,5-dichloro-α-methyl-, (αS,βR)-