CymitQuimica logo

CAS 127020-33-1

:

ETHYL 2-ACETAMIDO-2-ETHOXYCARBONYL-3-(2-ETHYL-5-METHYL-3-OXOISOXAZOLIN-4-YL) PROPIONATE

Description:
Ethyl 2-acetamido-2-ethoxycarbonyl-3-(2-ethyl-5-methyl-3-oxoisozaxolin-4-yl) propionate, with CAS number 127020-33-1, is a complex organic compound characterized by its unique structural features. It contains an ethyl ester functional group, an acetamido group, and a substituted isoxazoline ring, which contribute to its potential biological activity. The presence of the ethoxycarbonyl moiety suggests that it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. The isoxazoline ring is known for its involvement in various pharmacological activities, making this compound of interest in medicinal chemistry. Its molecular structure indicates potential for interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound may exhibit specific reactivity due to the presence of functional groups, which could be leveraged in synthetic applications or drug development. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C16H24N2O8
InChI:InChI=1/C16H24N2O8/c1-6-24-14(21)16(17-11(4)19,15(22)25-7-2)8-12-10(3)26-18(9-23-5)13(12)20/h6-9H2,1-5H3,(H,17,19)
SMILES:CCOC(=O)C(Cc1c(C)on(COC)c1=O)(C(=O)OCC)N=C(C)O
Synonyms:
  • 2-Acetylamino-2-(2-ethyl-5-methyl-3-oxo-2,3-dihydro-isoxazol-4-ylmethyl)-malonicAcidDiethylEster
  • Diethyl 2-Acetamido-2-[[2-(Methoxymethyl)-5-Methyl-3-Oxo-Isoxazol-4-Yl]Methyl]Propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.