CAS 127027-50-3
:2′-Deoxy-7,8-dihydro-8-oxo-5′-guanylic acid
Description:
2′-Deoxy-7,8-dihydro-8-oxo-5′-guanylic acid, also known as 8-oxo-dGMP, is a modified nucleotide that plays a significant role in cellular processes, particularly in the context of DNA damage and repair. This compound is characterized by the presence of an oxidized guanine base, which can result from oxidative stress, leading to potential mutagenic effects if not repaired. The structure features a deoxyribose sugar, a phosphate group, and a modified guanine base that contains a carbonyl group at the 8-position, contributing to its reactivity and biological significance. It is involved in various biochemical pathways, including those related to DNA synthesis and repair mechanisms. The presence of 8-oxo-dGMP in cells can serve as a marker for oxidative damage and is studied for its implications in aging and cancer. Its CAS number, 127027-50-3, is a unique identifier that facilitates the cataloging and research of this compound in scientific literature and databases.
Formula:C10H14N5O8P
InChI:InChI=1S/C10H14N5O8P/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(23-5)2-22-24(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,5+/m0/s1
InChI key:InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-N
SMILES:O=C1N(C2=C(N1)C(=O)N=C(N)N2)[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)C3
Synonyms:- 2′-Deoxy-7,8-dihydro-8-oxo-5′-guanylic acid
- 8-Hydroxy-2′-deoxyguanosine 5′-monophosphate
- 8-OxodGMP
- 5′-Guanylic acid, 2′-deoxy-7,8-dihydro-8-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
