CAS 127033-74-3
:(2E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide
Description:
(2E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide, with the CAS number 127033-74-3, is an organic compound characterized by its amide functional group and a conjugated double bond system. This compound features a phenyl group and a methoxy-substituted phenyl group, contributing to its aromatic character and potential for various interactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The (2E) configuration indicates that the double bond is in the trans configuration, which can affect the compound's geometry and reactivity. This compound may exhibit interesting properties such as potential anti-inflammatory or anticancer activities, making it a subject of interest in medicinal chemistry. Its structural features suggest that it could participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich aromatic rings and the reactive amide group. Overall, this compound's unique structure positions it as a valuable candidate for further research in both synthetic and pharmaceutical chemistry.
Formula:C16H15NO2
InChI:InChI=1/C16H15NO2/c1-19-15-9-5-8-14(12-15)17-16(18)11-10-13-6-3-2-4-7-13/h2-12H,1H3,(H,17,18)/b11-10+
Synonyms:- (2E)-N-(3-Methoxyphenyl)-3-phenylacrylamide
- 2-propenamide, N-(3-methoxyphenyl)-3-phenyl-, (2E)-
- N-(Cinnamoyl)-3-Methoxyaniline
- (2E)-N-(3-Methoxyphenyl)-3-phenyl-2-propenamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenamide, N-(3-methoxyphenyl)-3-phenyl-, (2E)-
CAS:Formula:C16H15NO2Purity:97%Color and Shape:SolidMolecular weight:253.2958N-(Cinnamoyl)-3-Methoxyaniline
CAS:N-(Cinnamoyl)-3-MethoxyanilinePurity:98%Molecular weight:253.30g/mol(E)-N-(3-METHOXYPHENYL)-3-PHENYL-2-PROPENAMIDE
CAS:Formula:C16H15NO2Purity:97%Molecular weight:253.301N-(3-Methoxyphenyl)cinnamamide
CAS:<p>N-(3-Methoxyphenyl)cinnamamide is a useful organic compound for research related to life sciences. The catalog number is T66991 and the CAS number is 127033-74-3.</p>Formula:C16H15NO2Color and Shape:SolidMolecular weight:253.301



