CAS 1270335-46-0

γ-Amino-4-quinolinepropanol

Description:

γ-Amino-4-quinolinepropanol is a chemical compound characterized by its unique structure, which includes a quinoline ring fused with a propanol chain and an amino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a ligand in various chemical reactions. γ-Amino-4-quinolinepropanol may also display solubility in polar solvents due to the hydroxyl group in the propanol moiety. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or infectious diseases. Additionally, the compound's quinoline framework is known for its role in various biological activities, including antimicrobial and antimalarial properties. As with many chemical substances, the specific reactivity and stability can be influenced by environmental factors such as pH and temperature, making it essential to consider these conditions in practical applications.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1S/C12H14N2O/c13-11(6-8-15)9-5-7-14-12-4-2-1-3-10(9)12/h1-5,7,11,15H,6,8,13H2

InChI key: InChIKey=AXJFPSISLDINNR-UHFFFAOYSA-N

SMILES: C(CCO)(N)C=1C2=C(N=CC1)C=CC=C2

Synonyms:

• γ-Amino-4-quinolinepropanol
• 4-Quinolinepropanol, γ-amino-