CAS 1270341-08-6

β-Amino-β-methyl-6-quinolineethanol

Description:

β-Amino-β-methyl-6-quinolineethanol is a chemical compound characterized by its unique structure, which includes a quinoline ring system fused with an ethanolamine moiety. This compound typically exhibits properties associated with both amines and alcohols, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the quinoline structure suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. The β-amino group may also contribute to its interaction with biological targets, potentially enhancing its efficacy in medicinal applications. Additionally, the methyl group at the β-position can affect the steric and electronic properties of the molecule, influencing its overall behavior in chemical reactions. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, β-Amino-β-methyl-6-quinolineethanol represents a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1S/C12H14N2O/c1-12(13,8-15)10-4-5-11-9(7-10)3-2-6-14-11/h2-7,15H,8,13H2,1H3

InChI key: InChIKey=SRPYPRKQVGOKNJ-UHFFFAOYSA-N

SMILES: C(CO)(C)(N)C1=CC2=C(C=C1)N=CC=C2

Synonyms:

• β-Amino-β-methyl-6-quinolineethanol
• 6-Quinolineethanol, β-amino-β-methyl-