CymitQuimica logo

CAS 1270353-92-8

:

β-Amino-β-methylcyclopentanepropanoic acid

Description:
β-Amino-β-methylcyclopentanepropanoic acid, identified by its CAS number 1270353-92-8, is a non-proteinogenic amino acid characterized by its unique cyclopentane structure. This compound features a β-amino group, which distinguishes it from standard amino acids, and a propanoic acid moiety that contributes to its acidic properties. The presence of the methyl group on the β-carbon enhances its steric properties, potentially influencing its interactions in biological systems. This amino acid is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential role as a building block for peptide synthesis and its implications in drug design. Its structural features may impart specific conformational characteristics, affecting how it interacts with enzymes and receptors. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of study for applications in pharmaceuticals and materials science. Overall, β-Amino-β-methylcyclopentanepropanoic acid represents a fascinating area of research within the realm of amino acid derivatives.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-9(10,6-8(11)12)7-4-2-3-5-7/h7H,2-6,10H2,1H3,(H,11,12)
InChI key:InChIKey=QAHSSUYWERNKMM-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C)(N)C1CCCC1
Synonyms:
  • β-Amino-β-methylcyclopentanepropanoic acid
  • Cyclopentanepropanoic acid, β-amino-β-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.