CymitQuimica logo

CAS 1270384-84-3

:

3-(2-Fluoro-6-nitrophenyl)morpholine

Description:
3-(2-Fluoro-6-nitrophenyl)morpholine is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a 2-fluoro-6-nitrophenyl group indicates that the compound has a fluorine atom and a nitro group attached to a phenyl ring, contributing to its unique reactivity and properties. This compound is likely to exhibit polar characteristics due to the electronegative fluorine and nitro groups, which can influence its solubility in various solvents. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in chemical reactions, particularly in electrophilic aromatic substitution. The morpholine moiety may also impart basicity and potential interactions with biological targets, making this compound of interest in medicinal chemistry and drug development. Overall, 3-(2-Fluoro-6-nitrophenyl)morpholine is a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H11FN2O3
InChI:InChI=1S/C10H11FN2O3/c11-7-2-1-3-9(13(14)15)10(7)8-6-16-5-4-12-8/h1-3,8,12H,4-6H2
InChI key:InChIKey=QFORXIIMQWSQPU-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C(F)=CC=C1)C2COCCN2
Synonyms:
  • 3-(2-Fluoro-6-nitrophenyl)morpholine
  • Morpholine, 3-(2-fluoro-6-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.