
CAS 1270385-05-1
:4-(3-Morpholinyl)-2-nitrophenol
Description:
4-(3-Morpholinyl)-2-nitrophenol, identified by its CAS number 1270385-05-1, is an organic compound characterized by the presence of a nitrophenol moiety substituted with a morpholine group. This compound typically exhibits a yellow to orange crystalline appearance, indicative of its nitro group. The morpholine ring contributes to its solubility in polar solvents, enhancing its potential applications in various chemical processes. The presence of both the nitro and phenolic functional groups suggests that it may exhibit acidic properties, allowing for potential interactions in biological systems or as a reagent in organic synthesis. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted to understand its toxicity and handling requirements, as nitrophenols can be hazardous. Overall, 4-(3-Morpholinyl)-2-nitrophenol represents a versatile compound with potential applications in both industrial and research settings.
Formula:C10H12N2O4
InChI:InChI=1S/C10H12N2O4/c13-10-2-1-7(5-9(10)12(14)15)8-6-16-4-3-11-8/h1-2,5,8,11,13H,3-4,6H2
InChI key:InChIKey=MFIPEYFUJJCFEW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1O)C2COCCN2
Synonyms:- Phenol, 4-(3-morpholinyl)-2-nitro-
- 4-(3-Morpholinyl)-2-nitrophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.