CAS 127046-45-1
:Pazufloxacin hydrochloride
Description:
Pazufloxacin hydrochloride is a synthetic fluoroquinolone antibiotic characterized by its broad-spectrum antibacterial activity. It is primarily effective against a variety of Gram-positive and Gram-negative bacteria, making it useful in treating various infections. The compound features a bicyclic core structure typical of fluoroquinolones, which contributes to its mechanism of action by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes critical for DNA replication and transcription. Pazufloxacin hydrochloride is typically administered in its hydrochloride salt form, enhancing its solubility and stability in aqueous solutions. The substance is known for its favorable pharmacokinetic properties, including good oral bioavailability and tissue penetration. However, like other antibiotics, it may be associated with potential side effects, including gastrointestinal disturbances and, in rare cases, effects on the central nervous system. As with any antibiotic, appropriate use is essential to minimize the risk of developing antibiotic resistance. Overall, pazufloxacin hydrochloride represents a valuable option in the arsenal against bacterial infections, particularly in settings where resistance to other antibiotics is a concern.
Formula:C16H16ClFN2O4
InChI:InChI=1/C16H15FN2O4.ClH/c1-7-6-23-14-11(16(18)2-3-16)10(17)4-8-12(14)19(7)5-9(13(8)20)15(21)22;/h4-5,7H,2-3,6,18H2,1H3,(H,21,22);1H/t7-;/m0./s1
SMILES:C[C@H]1COc2c(c(cc3c2n1cc(c3=O)C(=O)O)F)C1(CC1)N.Cl
Synonyms:- (3S)-10-(1-Aminocyclopropyl)-9-fluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Pazufloxacin hydrochloride
CAS:<p>Pazufloxacin hydrochloride is a synthetic antibacterial agent, which is derived from the fluoroquinolone class of antibiotics with a broad-spectrum activity against various bacterial pathogens. This compound, sourced through chemical synthesis, functions primarily by inhibiting bacterial DNA gyrase and topoisomerase IV, which are critical enzymes for DNA replication, transcription, repair, and recombination. The inhibition of these enzymes leads to the disruption of bacterial DNA processes, ultimately resulting in bacterial cell death.</p>Formula:C16H15FN2O4•HClPurity:Min. 95%Molecular weight:354.76 g/mol
