
CAS 1270471-63-0
:2-[5-(Trifluoromethyl)-2-thienyl]piperidine
Description:
2-[5-(Trifluoromethyl)-2-thienyl]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a thienyl group substituted with a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The thienyl moiety contributes to the compound's aromatic character, potentially affecting its electronic properties and reactivity. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its molecular structure suggests that it may exhibit interesting interactions with biological targets, which could be explored in drug discovery research. Additionally, the trifluoromethyl group is known to impart unique properties, such as increased metabolic stability and altered pharmacokinetics. Overall, 2-[5-(Trifluoromethyl)-2-thienyl]piperidine represents a class of compounds that may offer valuable insights into the design of novel drugs.
Formula:C10H12F3NS
InChI:InChI=1S/C10H12F3NS/c11-10(12,13)9-5-4-8(15-9)7-3-1-2-6-14-7/h4-5,7,14H,1-3,6H2
InChI key:InChIKey=IGELPZLAZQSXTM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1SC(=CC1)C2CCCCN2
Synonyms:- 2-[5-(Trifluoromethyl)-2-thienyl]piperidine
- Piperidine, 2-[5-(trifluoromethyl)-2-thienyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.