CAS 1270484-29-1

5-Methyl-2-(2-piperidinyl)phenol

Description:

5-Methyl-2-(2-piperidinyl)phenol is an organic compound characterized by its phenolic structure, which includes a methyl group and a piperidine substituent. This compound features a hydroxyl group (-OH) attached to a benzene ring, contributing to its classification as a phenol. The presence of the piperidine ring, a six-membered nitrogen-containing heterocycle, imparts unique properties, including potential biological activity. The methyl group at the 5-position of the phenol ring can influence the compound's solubility and reactivity. Generally, phenolic compounds exhibit antioxidant properties and can participate in various chemical reactions, such as electrophilic aromatic substitution. The specific arrangement of substituents in 5-Methyl-2-(2-piperidinyl)phenol may also affect its pharmacological profile, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for applications in research and industry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c1-9-5-6-10(12(14)8-9)11-4-2-3-7-13-11/h5-6,8,11,13-14H,2-4,7H2,1H3

InChI key: InChIKey=NRPHZQXCNBGOED-UHFFFAOYSA-N

SMILES: OC1=C(C2CCCCN2)C=CC(C)=C1

Synonyms:

• 5-Methyl-2-(2-piperidinyl)phenol
• Phenol, 5-methyl-2-(2-piperidinyl)-