CAS 1270484-81-5

β-Amino-4-hydroxy-3-nitrobenzeneethanol

Description:

β-Amino-4-hydroxy-3-nitrobenzeneethanol, identified by its CAS number 1270484-81-5, is a chemical compound characterized by the presence of an amino group, a hydroxyl group, and a nitro group attached to a benzene ring. This compound features a phenolic structure, which contributes to its potential reactivity and solubility in polar solvents. The amino group can participate in hydrogen bonding and may influence the compound's biological activity, while the nitro group can serve as a site for reduction reactions. The hydroxyl group enhances the compound's polarity, making it more soluble in water compared to non-polar compounds. Such structural features suggest that β-Amino-4-hydroxy-3-nitrobenzeneethanol may exhibit interesting pharmacological properties, potentially acting as a precursor in the synthesis of other organic compounds or as an intermediate in various chemical reactions. Its specific applications and behavior would depend on further studies, including its stability, reactivity under different conditions, and interactions with biological systems.

Formula: C₈H₁₀N₂O₄

InChI: InChI=1S/C8H10N2O4/c9-6(4-11)5-1-2-8(12)7(3-5)10(13)14/h1-3,6,11-12H,4,9H2

InChI key: InChIKey=MVHOALKAQWONGF-UHFFFAOYSA-N

SMILES: C(CO)(N)C1=CC(N(=O)=O)=C(O)C=C1

Synonyms:

• β-Amino-4-hydroxy-3-nitrobenzeneethanol
• Benzeneethanol, β-amino-4-hydroxy-3-nitro-