CAS 1270517-97-9

2-Bromo-α-ethyl-6-fluorobenzenemethanamine

Description:

2-Bromo-α-ethyl-6-fluorobenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and an ethyl group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine and fluorine substituents contribute to the compound's reactivity and influence its physical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific arrangement of substituents on the benzene ring can affect the compound's electronic properties and steric hindrance, which are crucial for its interaction with biological targets. Additionally, the compound's synthesis and stability can be influenced by the presence of halogens and the amino group, making it a subject of study in both organic synthesis and pharmacology.

Formula: C₉H₁₁BrFN

InChI: InChI=1S/C9H11BrFN/c1-2-8(12)9-6(10)4-3-5-7(9)11/h3-5,8H,2,12H2,1H3

InChI key: InChIKey=PEPLTTSJDZYFNY-UHFFFAOYSA-N

SMILES: C(CC)(N)C1=C(Br)C=CC=C1F

Synonyms:

• 2-Bromo-α-ethyl-6-fluorobenzenemethanamine
• Benzenemethanamine, 2-bromo-α-ethyl-6-fluoro-