CAS 1270533-77-1

1-Amino-1-(2,3-dichlorophenyl)-2-propanone

Description:

1-Amino-1-(2,3-dichlorophenyl)-2-propanone is an organic compound characterized by its amino and ketone functional groups, which contribute to its reactivity and potential applications in various chemical processes. The presence of the 2,3-dichlorophenyl group indicates that it has two chlorine atoms substituted on a phenyl ring, which can influence its electronic properties and hydrophobicity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the chlorinated aromatic system. The amino group can participate in hydrogen bonding, enhancing its interactions with other polar molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and handling require careful consideration of safety protocols due to the presence of chlorine, which can pose environmental and health risks. Overall, 1-Amino-1-(2,3-dichlorophenyl)-2-propanone is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₉Cl₂NO

InChI: InChI=1S/C9H9Cl2NO/c1-5(13)9(12)6-3-2-4-7(10)8(6)11/h2-4,9H,12H2,1H3

InChI key: InChIKey=ANKYDGHVRDEDAO-UHFFFAOYSA-N

SMILES: C(C(C)=O)(N)C1=C(Cl)C(Cl)=CC=C1

Synonyms:

• 2-Propanone, 1-amino-1-(2,3-dichlorophenyl)-
• 1-Amino-1-(2,3-dichlorophenyl)-2-propanone