CAS 1270540-72-1

2-(2,4,5-Trifluorophenyl)pyrrolidine

Description:

2-(2,4,5-Trifluorophenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a trifluorophenyl substituent. The presence of three fluorine atoms on the phenyl ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The trifluoromethyl groups can enhance the compound's stability and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2-(2,4,5-Trifluorophenyl)pyrrolidine is a compound of interest in both research and industrial applications due to its distinctive characteristics.

Formula: C₁₀H₁₀F₃N

InChI: InChI=1S/C10H10F3N/c11-7-5-9(13)8(12)4-6(7)10-2-1-3-14-10/h4-5,10,14H,1-3H2

InChI key: InChIKey=FQDLLPZPPGAYQY-UHFFFAOYSA-N

SMILES: FC1=C(C=C(F)C(F)=C1)C2CCCN2

Synonyms:

• Pyrrolidine, 2-(2,4,5-trifluorophenyl)-
• 2-(2,4,5-Trifluorophenyl)pyrrolidine