CymitQuimica logo

CAS 1270545-46-4

:

2-(5-Bromo-2-methylphenyl)pyrrolidine

Description:
2-(5-Bromo-2-methylphenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted aromatic group. The presence of a bromine atom and a methyl group on the phenyl ring contributes to its chemical reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the bromine substituent, which can influence its solubility in various solvents. The pyrrolidine moiety suggests potential applications in medicinal chemistry, as pyrrolidine derivatives are often explored for their biological activities. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. As with many brominated compounds, it is essential to consider safety and environmental implications during handling and disposal.
Formula:C11H14BrN
InChI:InChI=1S/C11H14BrN/c1-8-4-5-9(12)7-10(8)11-3-2-6-13-11/h4-5,7,11,13H,2-3,6H2,1H3
InChI key:InChIKey=FBSZWWZPOIIBMS-UHFFFAOYSA-N
SMILES:CC1=C(C=C(Br)C=C1)C2CCCN2
Synonyms:
  • Pyrrolidine, 2-(5-bromo-2-methylphenyl)-
  • 2-(5-Bromo-2-methylphenyl)pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.