
CAS 1270546-12-7
:2-(2,3-Dihydro-1H-inden-5-yl)piperidine
Description:
2-(2,3-Dihydro-1H-inden-5-yl)piperidine is a chemical compound characterized by its unique bicyclic structure, which combines a piperidine ring with a dihydroindene moiety. This compound features a piperidine ring, a six-membered nitrogen-containing ring, which contributes to its potential biological activity. The dihydroindene part of the molecule adds to its hydrophobic character and may influence its interaction with biological targets. The presence of both aliphatic and aromatic characteristics in its structure suggests that it may exhibit interesting pharmacological properties, potentially acting as a ligand for various receptors. Additionally, the compound's stereochemistry can play a significant role in its biological activity, affecting how it interacts with enzymes or receptors in the body. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H19N
InChI:InChI=1S/C14H19N/c1-2-9-15-14(6-1)13-8-7-11-4-3-5-12(11)10-13/h7-8,10,14-15H,1-6,9H2
InChI key:InChIKey=QIHSNVUCABWWHA-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)CCC2)C3CCCCN3
Synonyms:- 2-(2,3-Dihydro-1H-inden-5-yl)piperidine
- Piperidine, 2-(2,3-dihydro-1H-inden-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.