CAS 1270550-53-2

γ-Amino-4-bromo-3-methylbenzenepropanol

Description:

γ-Amino-4-bromo-3-methylbenzenepropanol, identified by its CAS number 1270550-53-2, is an organic compound characterized by the presence of an amino group, a bromine atom, and a propanol moiety attached to a benzene ring. This compound features a bromine substituent at the para position relative to the amino group, and a methyl group at the meta position, contributing to its unique chemical properties. The presence of the amino group suggests potential basicity and the ability to participate in hydrogen bonding, which can influence its solubility and reactivity. The propanol portion indicates that it may exhibit alcohol-like characteristics, such as being a potential solvent or reactant in various chemical reactions. Additionally, the bromine atom can serve as a site for nucleophilic substitution reactions, making this compound of interest in synthetic organic chemistry. Overall, γ-Amino-4-bromo-3-methylbenzenepropanol is a versatile compound with potential applications in pharmaceuticals and materials science, although specific applications would depend on further research and development.

Formula: C₁₀H₁₄BrNO

InChI: InChI=1S/C10H14BrNO/c1-7-6-8(2-3-9(7)11)10(12)4-5-13/h2-3,6,10,13H,4-5,12H2,1H3

InChI key: InChIKey=UZCNMGOKVSEYSU-UHFFFAOYSA-N

SMILES: C(CCO)(N)C1=CC(C)=C(Br)C=C1

Synonyms:

• Benzenepropanol, γ-amino-4-bromo-3-methyl-
• γ-Amino-4-bromo-3-methylbenzenepropanol