
CAS 1270560-26-3
:4-(Cyclopentyloxy)-α-(trifluoromethyl)benzenemethanamine
Description:
4-(Cyclopentyloxy)-α-(trifluoromethyl)benzenemethanamine, identified by its CAS number 1270560-26-3, is a chemical compound characterized by its unique molecular structure, which includes a cyclopentyloxy group and a trifluoromethyl group attached to a benzenemethanamine backbone. This compound is likely to exhibit properties typical of aromatic amines, such as potential basicity due to the amine functional group, and may participate in hydrogen bonding due to the presence of the amine. The trifluoromethyl group can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, the cyclopentyl moiety may contribute to steric effects, impacting the compound's interaction with biological targets. The presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's stability and solubility in various solvents. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could influence pharmacokinetics and pharmacodynamics.
Formula:C13H16F3NO
InChI:InChI=1S/C13H16F3NO/c14-13(15,16)12(17)9-5-7-11(8-6-9)18-10-3-1-2-4-10/h5-8,10,12H,1-4,17H2
InChI key:InChIKey=NDYGVXLZMYNOKV-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=CC=C(OC2CCCC2)C=C1
Synonyms:- Benzenemethanamine, 4-(cyclopentyloxy)-α-(trifluoromethyl)-
- 4-(Cyclopentyloxy)-α-(trifluoromethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.