CAS 1270569-51-1

α-(Methoxymethyl)-4-pyridinemethanamine

Description:

α-(Methoxymethyl)-4-pyridinemethanamine, identified by its CAS number 1270569-51-1, is a chemical compound that features a pyridine ring substituted with a methanamine group and a methoxymethyl group. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity and reactivity. The presence of the methoxymethyl group enhances its solubility in organic solvents and may influence its interaction with biological targets. The amine functional group suggests that it can participate in hydrogen bonding, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, the pyridine moiety can engage in coordination with metal ions, which may be relevant in catalysis or medicinal chemistry applications. Overall, this compound's unique structural features position it as a potentially valuable intermediate in organic synthesis or as a lead compound in drug discovery, although specific applications would depend on further research into its properties and biological effects.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-11-6-8(9)7-2-4-10-5-3-7/h2-5,8H,6,9H2,1H3

InChI key: InChIKey=WPAZIGDNUANDSC-UHFFFAOYSA-N

SMILES: C(COC)(N)C=1C=CN=CC1

Synonyms:

• 4-Pyridinemethanamine, α-(methoxymethyl)-
• α-(Methoxymethyl)-4-pyridinemethanamine