CymitQuimica logo

CAS 1270583-87-3

:

4-(Aminocyclopropylmethyl)benzonitrile

Description:
4-(Aminocyclopropylmethyl)benzonitrile, identified by its CAS number 1270583-87-3, is a chemical compound characterized by its unique structure that includes a benzonitrile moiety and an aminocyclopropyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the nitrile group (-C≡N) contributes to its polarity and potential for hydrogen bonding, while the amino group (-NH2) can act as a nucleophile in various chemical reactions. The cyclopropyl ring adds strain and can affect the compound's overall stability and reactivity. In terms of applications, compounds like this may be explored in medicinal chemistry for their potential biological activities, particularly in drug development. However, specific characteristics such as solubility, melting point, and spectral data would require empirical measurement or detailed literature references for precise information. Overall, 4-(Aminocyclopropylmethyl)benzonitrile represents a versatile structure with potential implications in various chemical and pharmaceutical contexts.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c12-7-8-1-3-9(4-2-8)11(13)10-5-6-10/h1-4,10-11H,5-6,13H2
InChI key:InChIKey=JRXWWKGCTHCWJG-UHFFFAOYSA-N
SMILES:C(N)(C1=CC=C(C#N)C=C1)C2CC2
Synonyms:
  • 4-(Aminocyclopropylmethyl)benzonitrile
  • Benzonitrile, 4-(aminocyclopropylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.