
CAS 1270583-88-4
:2-(3,5-Difluorophenyl)azetidine
Description:
2-(3,5-Difluorophenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 3,5-difluorophenyl group indicates that the compound has two fluorine substituents on a phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. This compound may exhibit interesting biological activities due to the presence of the azetidine moiety, which is often found in various pharmaceuticals. The fluorine atoms can enhance the compound's lipophilicity and metabolic stability, making it a subject of interest in medicinal chemistry. Additionally, the molecular structure suggests potential for diverse interactions with biological targets, which could be explored in drug development. Overall, 2-(3,5-Difluorophenyl)azetidine represents a unique scaffold that combines the properties of both the azetidine and difluorophenyl groups, making it a valuable compound for further research and application in various fields, including pharmaceuticals and materials science.
Formula:C9H9F2N
InChI:InChI=1S/C9H9F2N/c10-7-3-6(4-8(11)5-7)9-1-2-12-9/h3-5,9,12H,1-2H2
InChI key:InChIKey=MRVUQBYSZWTLLA-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2CCN2
Synonyms:- Azetidine, 2-(3,5-difluorophenyl)-
- 2-(3,5-Difluorophenyl)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.