
CAS 127073-70-5
:2-[(2-Methyl-2-propen-1-yl)(phenylmethyl)amino]acetonitrile
Description:
2-[(2-Methyl-2-propen-1-yl)(phenylmethyl)amino]acetonitrile, with the CAS number 127073-70-5, is an organic compound characterized by its unique structure that includes an acetonitrile functional group and an amino group attached to a branched alkene. This compound features a 2-methyl-2-propen-1-yl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the phenylmethyl group enhances its lipophilicity, making it more soluble in organic solvents. The nitrile functional group (–C≡N) is known for its polar characteristics, which can influence the compound's interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and reactivity can be explored in the context of various chemical reactions, including nucleophilic substitutions and polymerizations. Overall, 2-[(2-Methyl-2-propen-1-yl)(phenylmethyl)amino]acetonitrile represents a versatile structure with potential applications in both research and industry.
Formula:C13H16N2
InChI:InChI=1S/C13H16N2/c1-12(2)10-15(9-8-14)11-13-6-4-3-5-7-13/h3-7H,1,9-11H2,2H3
InChI key:InChIKey=VISQPLPAQLRKCK-UHFFFAOYSA-N
SMILES:C(N(CC(C)=C)CC#N)C1=CC=CC=C1
Synonyms:- 2-[(2-Methyl-2-propen-1-yl)(phenylmethyl)amino]acetonitrile
- 2-[Benzyl(2-methylprop-2-en-1-yl)amino]acetonitrile
- [(2-Methyl-2-propenyl)(phenylmethyl)amino]acetonitrile
- Acetonitrile, [(2-methyl-2-propenyl)(phenylmethyl)amino]-
- Acetonitrile, 2-[(2-methyl-2-propen-1-yl)(phenylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.