CAS 127098-14-0
:2,3-Dihydroxypropyl hexacosanoate
Description:
2,3-Dihydroxypropyl hexacosanoate, with the CAS number 127098-14-0, is an ester derived from hexacosanoic acid and 2,3-dihydroxypropyl alcohol. This compound features a long-chain fatty acid, hexacosanoic acid, which contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The presence of hydroxyl groups in the 2,3 positions of the propyl chain introduces polar characteristics, which can enhance its interactions with other polar substances. This dual nature allows it to function effectively in various applications, including as an emulsifier or surfactant in cosmetic formulations and food products. Additionally, its long carbon chain may impart properties such as increased viscosity and stability. The compound is likely to exhibit low volatility and a relatively high melting point due to its long hydrocarbon chain. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, 2,3-Dihydroxypropyl hexacosanoate is characterized by its unique structural features that influence its physical and chemical properties.
Formula:C29H58O4
InChI:InChI=1S/C29H58O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29(32)33-27-28(31)26-30/h28,30-31H,2-27H2,1H3
InChI key:InChIKey=QAJHAMGOPUEFRR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCCCCC)CC(OCC(CO)O)=O
Synonyms:- 2,3-Dihydroxypropyl hexacosanoate
- Hexacosanoic acid, 2,3-dihydroxypropyl ester
- Glyceryl-1-hexacosanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Glyceryl hexacosanoate
CAS:Glyceryl hexacosanoate is a natural product for research related to life sciences. The catalog number is TN5816 and the CAS number is 127098-14-0.
Formula:C29H58O4Purity:98%Color and Shape:SolidMolecular weight:470.77Glyceryl hexacosanoate
CAS:Glyceryl hexacosanoate is a synthetic ester that is commonly used in cosmetic formulations and industrial applications. It is derived from the esterification of glycerol and hexacosanoic acid, a long-chain fatty acid. With its unique molecular structure, glyceryl hexacosanoate functions by forming a lipid barrier on the surface of the skin or material it is applied to, thereby enhancing moisture retention and providing a smooth texture.Formula:C29H58O4Purity:Min. 95%Molecular weight:470.8 g/mol


