CAS 127104-26-1
:N-Hydroxy-α-methyl-2-pyridinemethanamine
Description:
N-Hydroxy-α-methyl-2-pyridinemethanamine, with the CAS number 127104-26-1, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a hydroxylamine functional group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxyl group. It exhibits properties associated with both amines and hydroxylamines, making it a versatile intermediate in organic synthesis. The presence of the α-methyl group can influence its reactivity and steric properties, potentially affecting its interactions in biological systems. N-Hydroxy-α-methyl-2-pyridinemethanamine may be utilized in various applications, including pharmaceuticals and agrochemicals, where it can serve as a building block for more complex molecules. Additionally, its ability to form stable complexes with metal ions may be of interest in coordination chemistry. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-6(9-10)7-4-2-3-5-8-7/h2-6,9-10H,1H3
InChI key:InChIKey=PRVMDFCARKTSAK-UHFFFAOYSA-N
SMILES:C(NO)(C)C1=CC=CC=N1
Synonyms:- 2-Pyridinemethanamine, N-hydroxy-α-methyl-
- 2-Pyridinemethanamine, N-hydroxy-α-methyl-, (±)-
- N-Hydroxy-α-methyl-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
