
CAS 127107-29-3
:1H-Pyrazol-3-amine, 1-methyl-, hydrochloride (1:1)
Description:
1H-Pyrazol-3-amine, 1-methyl-, hydrochloride (1:1), with the CAS number 127107-29-3, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group at the 3-position and a methyl group at the 1-position of the pyrazole ring, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the hydrochloride indicates that the compound is protonated, which can influence its stability, solubility, and interaction with biological systems. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in medicinal chemistry. However, specific biological activities and applications would require further investigation through empirical studies. Safety data and handling precautions should be adhered to, as with all chemical substances.
Formula:C4H7N3·ClH
InChI:InChI=1S/C4H7N3.ClH/c1-7-3-2-4(5)6-7;/h2-3H,1H3,(H2,5,6);1H
InChI key:InChIKey=TUDAAXXXYJNTBQ-UHFFFAOYSA-N
SMILES:NC1=NN(C)C=C1.Cl
Synonyms:- 1H-Pyrazol-3-amine, 1-methyl-, monohydrochloride
- 1H-Pyrazol-3-amine, 1-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.