CAS 127126-21-0
:(7S)-7-(Dipropylamino)-4-fluoro-5,6,7,8-tetrahydro-1-naphthalenol
Description:
(7S)-7-(Dipropylamino)-4-fluoro-5,6,7,8-tetrahydro-1-naphthalenol is a chemical compound characterized by its complex structure, which includes a naphthalene core with a tetrahydro configuration, indicating the presence of a saturated ring system. The compound features a dipropylamino group, which contributes to its basicity and potential interactions with biological systems, particularly in pharmacological contexts. The presence of a fluorine atom at the 4-position enhances its lipophilicity and may influence its binding affinity to various receptors. This compound is likely to exhibit chiral properties due to the presence of a stereocenter at the 7-position, which can affect its biological activity and pharmacokinetics. Its solubility and stability are influenced by the functional groups present, making it relevant in medicinal chemistry. Overall, this compound may have applications in drug development, particularly in areas targeting the central nervous system or other therapeutic areas where naphthalene derivatives are of interest.
Formula:C16H24FNO
InChI:InChI=1/C16H24FNO/c1-3-9-18(10-4-2)12-5-6-13-14(11-12)16(19)8-7-15(13)17/h7-8,12,19H,3-6,9-11H2,1-2H3/t12-/m0/s1
InChI key:InChIKey=FNKBVTBXFLSTPB-LBPRGKRZSA-N
SMILES:OC1=C2C(=C(F)C=C1)CC[C@H](N(CCC)CCC)C2
Synonyms:- (7S)-7-(Dipropylamino)-4-fluoro-5,6,7,8-tetrahydro-1-naphthalenol
- (S)-5-Fluoro-8-hydroxy-2-(dipropylamino)tetralin
- (S)-7-(Dipropylamino)-4-fluoro-5,6,7,8-tetrahydronaphthalen-1-ol
- 1-Naphthalenol, 7-(dipropylamino)-4-fluoro-5,6,7,8-tetrahydro-, (S)-
- 1-naphthalenol, 7-(dipropylamino)-4-fluoro-5,6,7,8-tetrahydro-, (7S)-
- (S)-4-Fluoro-5,6,7,8-tetrahydro-7α-dipropylamino-1-naphthol
- S(-)-UH-301 HYDROCHLORIDE (S(-)-5-FLUORO -8-HYDROXY-DPAT HYDROC
- S(-) UH-301 HCL
- UH 301
- (S)-UH-301
- 5-Fluoro-8-OH-DPAT
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
UH 301
CAS:UH 301 is a 5-HT1A receptor antagonist.Formula:C16H24FNOColor and Shape:SolidMolecular weight:265.37
