CymitQuimica logo

CAS 127143-18-4

:

ETHYL 3-(BENZOYLAMINO)-2-OXO-6-PHENYL-2H-PYRAN-5-CARBOXYLATE

Description:
Ethyl 3-(benzoylamino)-2-oxo-6-phenyl-2H-pyran-5-carboxylate, with the CAS number 127143-18-4, is a chemical compound characterized by its complex structure, which includes a pyran ring fused with a phenyl group and a carboxylate ester. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the benzoylamino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and acylation. Its oxo and carboxylate functionalities can also contribute to its reactivity and interaction with other molecules. Ethyl esters like this compound are often used in organic synthesis and may have applications in pharmaceuticals or agrochemicals due to their potential bioactivity. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and industry.
Formula:C21H17NO5
InChI:InChI=1/C21H17NO5/c1-2-26-20(24)16-13-17(22-19(23)15-11-7-4-8-12-15)21(25)27-18(16)14-9-5-3-6-10-14/h3-13H,2H2,1H3,(H,22,23)
SMILES:CCOC(=O)c1cc(c(=O)oc1c1ccccc1)N=C(c1ccccc1)O
Synonyms:
  • ethyl 2-oxo-6-phenyl-3-[(phenylcarbonyl)amino]-2H-pyran-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.