CAS 127143-19-5
:N-(5-Benzoyl-6-methyl-2-oxo-2H-pyran-3-yl)benzamide
Description:
N-(5-Benzoyl-6-methyl-2-oxo-2H-pyran-3-yl)benzamide, with the CAS number 127143-19-5, is a chemical compound that belongs to the class of pyran derivatives. This substance features a pyran ring fused with a benzoyl group and an amide functional group, which contributes to its structural complexity and potential reactivity. The presence of the carbonyl groups in both the pyran and amide structures suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and potential for π-π stacking interactions. Its unique structure may confer biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, N-(5-Benzoyl-6-methyl-2-oxo-2H-pyran-3-yl)benzamide represents a fascinating subject for further research in organic and medicinal chemistry.
Formula:C20H15NO4
InChI:InChI=1S/C20H15NO4/c1-13-16(18(22)14-8-4-2-5-9-14)12-17(20(24)25-13)21-19(23)15-10-6-3-7-11-15/h2-12H,1H3,(H,21,23)
InChI key:InChIKey=OECHXMGVPRCCIN-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(NC(=O)C2=CC=CC=C2)C(=O)OC1C)C3=CC=CC=C3
Synonyms:- N-(5-Benzoyl-6-methyl-2-oxo-2H-pyran-3-yl)benzamide
- Benzamide, N-(5-benzoyl-6-methyl-2-oxo-2H-pyran-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
