CymitQuimica logo

CAS 127168-91-6

:

Benzoic acid, 2,3-bis(bromomethyl)-, methyl ester

Description:
Benzoic acid, 2,3-bis(bromomethyl)-, methyl ester, with the CAS number 127168-91-6, is an organic compound characterized by its ester functional group and the presence of bromomethyl substituents on the benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic structure. The presence of bromine atoms enhances its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the methyl ester group contributes to its potential as a flavoring agent or preservative in food applications. Safety considerations include handling precautions due to its potential irritant properties and the need for proper storage to prevent degradation. Overall, this compound is of interest in both industrial and research settings due to its unique chemical properties and reactivity.
Formula:C10H10Br2O2
InChI:InChI=1S/C10H10Br2O2/c1-14-10(13)8-4-2-3-7(5-11)9(8)6-12/h2-4H,5-6H2,1H3
InChI key:InChIKey=AIZKAMIZWQQDNG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CBr)C(CBr)=CC=C1
Synonyms:
  • Benzoic acid, 2,3-bis(bromomethyl)-, methyl ester
  • Methyl 2,3-bis(bromomethyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.