CAS 127168-95-0
:2,3-Dihydro-1H-isoindole-4-methanol
Description:
2,3-Dihydro-1H-isoindole-4-methanol is a chemical compound characterized by its bicyclic structure, which includes an isoindole moiety. This compound features a saturated five-membered ring fused to a six-membered aromatic ring, contributing to its unique chemical properties. The presence of a hydroxymethyl group (-CH2OH) at the 4-position enhances its reactivity and solubility in polar solvents. It is typically a white to off-white solid at room temperature and may exhibit moderate stability under standard conditions. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H11NO
InChI:InChI=1S/C9H11NO/c11-6-8-3-1-2-7-4-10-5-9(7)8/h1-3,10-11H,4-6H2
InChI key:InChIKey=CMBJRRZLAYYBOP-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(CNC2)=CC=C1
Synonyms:- 2,3-Dihydro-1H-isoindol-4-ylmethanol
- 2,3-Dihydro-1H-isoindole-4-methanol
- (2,3-Dihydro-1H-isoindol-4-yl)-methanol
- 1H-Isoindole-4-methanol, 2,3-dihydro-
- 4-(Hydroxymethyl)isoindoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
